C16H29F3N2O — CID 123546739
5-Ethyl-4-octan-3-yl-1-(2,2,2-trifluoroethyl)-1,3-diazinan-2-one (PubChem CID 123546739) has the molecular formula C16H29F3N2O and a molecular weight of 322.41 g/mol. Its IUPAC name is 5-ethyl-4-octan-3-yl-1-(2,2,2-trifluoroethyl)-1,3-diazinan-2-one.
| Compound Name | 5-Ethyl-4-octan-3-yl-1-(2,2,2-trifluoroethyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 123546739 |
| Molecular Formula | C16H29F3N2O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | 5-ethyl-4-octan-3-yl-1-(2,2,2-trifluoroethyl)-1,3-diazinan-2-one |
| SMILES | CCCCCC(CC)C1C(CN(C(=O)N1)CC(F)(F)F)CC |
| InChI | InChI=1S/C16H29F3N2O/c1-4-7-8-9-12(5-2)14-13(6-3)10-21(15(22)20-14)11-16(17,18)19/h12-14H,4-11H2,1-3H3,(H,20,22) |
| InChIKey | WFZSUTHEMREQRZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 32.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | 347 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|