C21H22BrFN4O2 — CID 123546953
prop-1-en-2-yl N-[4-bromo-5-[1-ethyl-7-(methylamino)-2H-1,6-naphthyridin-3-yl]-2-fluorophenyl]carbamate (PubChem CID 123546953) has the molecular formula C21H22BrFN4O2 and a molecular weight of 461.34 g/mol. Its IUPAC name is prop-1-en-2-yl N-[4-bromo-5-[1-ethyl-7-(methylamino)-2H-1,6-naphthyridin-3-yl]-2-fluorophenyl]carbamate.
| Compound Name | prop-1-en-2-yl N-[4-bromo-5-[1-ethyl-7-(methylamino)-2H-1,6-naphthyridin-3-yl]-2-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 123546953 |
| Molecular Formula | C21H22BrFN4O2 |
| Molecular Weight | 461.34 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | prop-1-en-2-yl N-[4-bromo-5-[1-ethyl-7-(methylamino)-2H-1,6-naphthyridin-3-yl]-2-fluorophenyl]carbamate |
| SMILES | C=C(C)OC(=O)Nc1cc(C2=Cc3cnc(NC)cc3N(CC)C2)c(Br)cc1F |
| InChI | InChI=1S/C21H22BrFN4O2/c1-5-27-11-14(6-13-10-25-20(24-4)9-19(13)27)15-7-18(17(23)8-16(15)22)26-21(28)29-12(2)3/h6-10H,2,5,11H2,1,3-4H3,(H,24,25)(H,26,28) |
| InChIKey | ZSRLVWBTVODQSB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.34 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|