C25H27N2O3+ — CID 123548311
3-[2-[2-(4-ethyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)ethenyl]-1,3-benzoxazol-3-ium-3-yl]propanoic acid (PubChem CID 123548311) has the molecular formula C25H27N2O3+ and a molecular weight of 403.50 g/mol. Its IUPAC name is 3-[2-[2-(4-ethyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)ethenyl]-1,3-benzoxazol-3-ium-3-yl]propanoic acid.
| Compound Name | 3-[2-[2-(4-ethyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)ethenyl]-1,3-benzoxazol-3-ium-3-yl]propanoic acid |
|---|---|
| PubChem CID | 123548311 |
| Molecular Formula | C25H27N2O3+ |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 3-[2-[2-(4-ethyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl)ethenyl]-1,3-benzoxazol-3-ium-3-yl]propanoic acid |
| SMILES | CCN1c2ccc(C=Cc3oc4ccccc4[n+]3CCC(=O)O)cc2C2CCCC21 |
| InChI | InChI=1S/C25H26N2O3/c1-2-26-20-8-5-6-18(20)19-16-17(10-12-21(19)26)11-13-24-27(15-14-25(28)29)22-7-3-4-9-23(22)30-24/h3-4,7,9-13,16,18,20H,2,5-6,8,14-15H2,1H3/p+1 |
| InChIKey | ZTCHZNGKTLLQOB-UHFFFAOYSA-O |
| XLogP | 4.84 |
| TPSA | 57.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|