C23H22O5 — CID 123548378
3-[[(1S,6S,7R)-6-ethyl-5-oxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-yl]oxymethylidene]-4,8b-dihydro-3aH-indeno[1,2-b]furan-2-one (PubChem CID 123548378) has the molecular formula C23H22O5 and a molecular weight of 378.42 g/mol. Its IUPAC name is 3-[[(1S,6S,7R)-6-ethyl-5-oxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-yl]oxymethylidene]-4,8b-dihydro-3aH-indeno[1,2-b]furan-2-one.
| Compound Name | 3-[[(1S,6S,7R)-6-ethyl-5-oxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-yl]oxymethylidene]-4,8b-dihydro-3aH-indeno[1,2-b]furan-2-one |
|---|---|
| PubChem CID | 123548378 |
| Molecular Formula | C23H22O5 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 3-[[(1S,6S,7R)-6-ethyl-5-oxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-3-yl]oxymethylidene]-4,8b-dihydro-3aH-indeno[1,2-b]furan-2-one |
| SMILES | CC[C@@]12C(=O)OC(OC=C3C(=O)OC4c5ccccc5CC34)C1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C23H22O5/c1-2-23-14-8-7-13(9-14)18(23)21(28-22(23)25)26-11-17-16-10-12-5-3-4-6-15(12)19(16)27-20(17)24/h3-8,11,13-14,16,18-19,21H,2,9-10H2,1H3/t13-,14+,16?,18?,19?,21?,23+/m1/s1 |
| InChIKey | XYJCUZFOOINMDM-QHDGFYBLSA-N |
| XLogP | 3.46 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|