C23H22ClFN2O2 — CID 123548412
1-[6-(3-chloro-5-fluoro-4-hydroxyphenyl)-4-(cyclohexylamino)quinolin-3-yl]ethanone (PubChem CID 123548412) has the molecular formula C23H22ClFN2O2 and a molecular weight of 412.89 g/mol. Its IUPAC name is 1-[6-(3-chloro-5-fluoro-4-hydroxyphenyl)-4-(cyclohexylamino)quinolin-3-yl]ethanone.
| Compound Name | 1-[6-(3-chloro-5-fluoro-4-hydroxyphenyl)-4-(cyclohexylamino)quinolin-3-yl]ethanone |
|---|---|
| PubChem CID | 123548412 |
| Molecular Formula | C23H22ClFN2O2 |
| Molecular Weight | 412.89 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 1-[6-(3-chloro-5-fluoro-4-hydroxyphenyl)-4-(cyclohexylamino)quinolin-3-yl]ethanone |
| SMILES | CC(=O)c1cnc2ccc(-c3cc(F)c(O)c(Cl)c3)cc2c1NC1CCCCC1 |
| InChI | InChI=1S/C23H22ClFN2O2/c1-13(28)18-12-26-21-8-7-14(15-10-19(24)23(29)20(25)11-15)9-17(21)22(18)27-16-5-3-2-4-6-16/h7-12,16,29H,2-6H2,1H3,(H,26,27) |
| InChIKey | NYJIOTVFUBCRIG-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.89 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |