C25H22ClF3N6O3S — CID 123548413
4-[5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]-N-methoxypiperazine-2-carboxamide (PubChem CID 123548413) has the molecular formula C25H22ClF3N6O3S and a molecular weight of 579.00 g/mol. Its IUPAC name is 4-[5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]-N-methoxypiperazine-2-carboxamide.
| Compound Name | 4-[5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]-N-methoxypiperazine-2-carboxamide |
|---|---|
| PubChem CID | 123548413 |
| Molecular Formula | C25H22ClF3N6O3S |
| Molecular Weight | 579.00 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | 4-[5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]-N-methoxypiperazine-2-carboxamide |
| SMILES | CONC(=O)C1CN(C2=NC(=O)C(=Cc3ccc4c(cnn4Cc4ccc(Cl)cc4C(F)(F)F)c3)S2)CCN1 |
| InChI | InChI=1S/C25H22ClF3N6O3S/c1-38-33-22(36)19-13-34(7-6-30-19)24-32-23(37)21(39-24)9-14-2-5-20-16(8-14)11-31-35(20)12-15-3-4-17(26)10-18(15)25(27,28)29/h2-5,8-11,19,30H,6-7,12-13H2,1H3,(H,33,36) |
| InChIKey | CSWBCSYFAODELQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.00 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|