C12H19N5O3 — CID 123548458
(Z)-3-[[N-[2-(1-isocyanatopropan-2-ylamino)-2-oxoethyl]-C-methylcarbonimidoyl]amino]but-2-enamide (PubChem CID 123548458) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is (Z)-3-[[N-[2-(1-isocyanatopropan-2-ylamino)-2-oxoethyl]-C-methylcarbonimidoyl]amino]but-2-enamide.
| Compound Name | (Z)-3-[[N-[2-(1-isocyanatopropan-2-ylamino)-2-oxoethyl]-C-methylcarbonimidoyl]amino]but-2-enamide |
|---|---|
| PubChem CID | 123548458 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (Z)-3-[[N-[2-(1-isocyanatopropan-2-ylamino)-2-oxoethyl]-C-methylcarbonimidoyl]amino]but-2-enamide |
| SMILES | C/C(=C/C(N)=O)N/C(C)=N/CC(=O)NC(C)CN=C=O |
| InChI | InChI=1S/C12H19N5O3/c1-8(4-11(13)19)16-10(3)15-6-12(20)17-9(2)5-14-7-18/h4,9H,5-6H2,1-3H3,(H2,13,19)(H,15,16)(H,17,20)/b8-4- |
| InChIKey | YIFCDICPKRMYQN-YWEYNIOJSA-N |
| XLogP | -0.78 |
| TPSA | 126.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|