C10H14N2 — CID 123548736
1,2,3,3a,5a,8,8a,8b-octahydrocyclopenta[e]indazole (PubChem CID 123548736) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 1,2,3,3a,5a,8,8a,8b-octahydrocyclopenta[e]indazole.
| Compound Name | 1,2,3,3a,5a,8,8a,8b-octahydrocyclopenta[e]indazole |
|---|---|
| PubChem CID | 123548736 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1,2,3,3a,5a,8,8a,8b-octahydrocyclopenta[e]indazole |
| SMILES | C1=CC2C=CC3NNCC3C2C1 |
| InChI | InChI=1S/C10H14N2/c1-2-7-4-5-10-9(6-11-12-10)8(7)3-1/h1-2,4-5,7-12H,3,6H2 |
| InChIKey | CIYRRLSTMNGSCS-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|