About 4,5-difluoro-3,6-dimethylhepta-3,5-dien-1-yne
4,5-difluoro-3,6-dimethylhepta-3,5-dien-1-yne (PubChem CID 123548874) has the molecular formula C9H10F2
and a molecular weight of 156.17 g/mol. Its IUPAC name is 4,5-difluoro-3,6-dimethylhepta-3,5-dien-1-yne.
Molecular Properties
| Compound Name | 4,5-difluoro-3,6-dimethylhepta-3,5-dien-1-yne |
| PubChem CID | 123548874 |
| Molecular Formula | C9H10F2 |
| Molecular Weight | 156.17 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 4,5-difluoro-3,6-dimethylhepta-3,5-dien-1-yne |
| SMILES | C#CC(C)=C(F)C(F)=C(C)C |
| InChI | InChI=1S/C9H10F2/c1-5-7(4)9(11)8(10)6(2)3/h1H,2-4H3 |
| InChIKey | YZSOVIVSFKYAGM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.17 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,5-difluoro-3,6-dimethylhepta-3,5-dien-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-difluoro-3,6-dimethylhepta-3,5-dien-1-yne?
The IUPAC name of 4,5-difluoro-3,6-dimethylhepta-3,5-dien-1-yne (CID 123548874) is 4,5-difluoro-3,6-dimethylhepta-3,5-dien-1-yne.
What is the SMILES notation for 4,5-difluoro-3,6-dimethylhepta-3,5-dien-1-yne?
The canonical SMILES for 4,5-difluoro-3,6-dimethylhepta-3,5-dien-1-yne is C#CC(C)=C(F)C(F)=C(C)C.
What is the InChIKey of 4,5-difluoro-3,6-dimethylhepta-3,5-dien-1-yne?
The InChIKey is YZSOVIVSFKYAGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2/c1-5-7(4)9(11)8(10)6(2)3/h1H,2-4H3.
What are the key properties of 4,5-difluoro-3,6-dimethylhepta-3,5-dien-1-yne?
4,5-difluoro-3,6-dimethylhepta-3,5-dien-1-yne has a molecular weight of 156.17 g/mol, XLogP of 3.13, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-difluoro-3,6-dimethylhepta-3,5-dien-1-yne is sourced from PubChem (CID 123548874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).