C26H36Cl2N6O3 — CID 123549057
2-chloroacetyl chloride;3-methoxy-N-(1-methylpiperidin-4-yl)-4-[(5-methyl-4-piperidin-1-ylpyrimidin-2-yl)amino]benzamide (PubChem CID 123549057) has the molecular formula C26H36Cl2N6O3 and a molecular weight of 551.52 g/mol. Its IUPAC name is 2-chloroacetyl chloride;3-methoxy-N-(1-methylpiperidin-4-yl)-4-[(5-methyl-4-piperidin-1-ylpyrimidin-2-yl)amino]benzamide.
| Compound Name | 2-chloroacetyl chloride;3-methoxy-N-(1-methylpiperidin-4-yl)-4-[(5-methyl-4-piperidin-1-ylpyrimidin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 123549057 |
| Molecular Formula | C26H36Cl2N6O3 |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | 2-chloroacetyl chloride;3-methoxy-N-(1-methylpiperidin-4-yl)-4-[(5-methyl-4-piperidin-1-ylpyrimidin-2-yl)amino]benzamide |
| SMILES | COc1cc(C(=O)NC2CCN(C)CC2)ccc1Nc1ncc(C)c(N2CCCCC2)n1.O=C(Cl)CCl |
| InChI | InChI=1S/C24H34N6O2.C2H2Cl2O/c1-17-16-25-24(28-22(17)30-11-5-4-6-12-30)27-20-8-7-18(15-21(20)32-3)23(31)26-19-9-13-29(2)14-10-19;3-1-2(4)5/h7-8,15-16,19H,4-6,9-14H2,1-3H3,(H,26,31)(H,25,27,28);1H2 |
| InChIKey | BZSIALPOTCSMGJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|