C18H25BO2 — CID 123549094
2-(5-cyclohexa-1,5-dien-1-ylcyclohexa-1,3-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 123549094) has the molecular formula C18H25BO2 and a molecular weight of 284.21 g/mol. Its IUPAC name is 2-(5-cyclohexa-1,5-dien-1-ylcyclohexa-1,3-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(5-cyclohexa-1,5-dien-1-ylcyclohexa-1,3-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 123549094 |
| Molecular Formula | C18H25BO2 |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2-(5-cyclohexa-1,5-dien-1-ylcyclohexa-1,3-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C2=CC=CC(C3=CCCC=C3)C2)OC1(C)C |
| InChI | InChI=1S/C18H25BO2/c1-17(2)18(3,4)21-19(20-17)16-12-8-11-15(13-16)14-9-6-5-7-10-14/h6,8-12,15H,5,7,13H2,1-4H3 |
| InChIKey | JOHJGFJYRVJDRR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|