C17H30O2 — CID 123549203
(1S,4S,4aS,5S,6R,7S,8aR)-6-but-2-en-2-yl-5-(hydroxymethyl)-4,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol (PubChem CID 123549203) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is (1S,4S,4aS,5S,6R,7S,8aR)-6-but-2-en-2-yl-5-(hydroxymethyl)-4,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol.
| Compound Name | (1S,4S,4aS,5S,6R,7S,8aR)-6-but-2-en-2-yl-5-(hydroxymethyl)-4,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 123549203 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (1S,4S,4aS,5S,6R,7S,8aR)-6-but-2-en-2-yl-5-(hydroxymethyl)-4,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol |
| SMILES | CC=C(C)[C@H]1[C@@H](CO)[C@H]2[C@@H](C[C@@H]1C)[C@@H](O)CC[C@@H]2C |
| InChI | InChI=1S/C17H30O2/c1-5-10(2)16-12(4)8-13-15(19)7-6-11(3)17(13)14(16)9-18/h5,11-19H,6-9H2,1-4H3/t11-,12-,13-,14+,15-,16+,17+/m0/s1 |
| InChIKey | IZNOUGBCJMRVQC-HZLIJHQHSA-N |
| XLogP | 3.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|