C9H9F3N3+ — CID 123549338
4,6-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-4-ium (PubChem CID 123549338) has the molecular formula C9H9F3N3+ and a molecular weight of 216.19 g/mol. Its IUPAC name is 4,6-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-4-ium.
| Compound Name | 4,6-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-4-ium |
|---|---|
| PubChem CID | 123549338 |
| Molecular Formula | C9H9F3N3+ |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 4,6-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-4-ium |
| SMILES | CC1=C[N+]2(C)C(=NN=C2C(F)(F)F)C=C1 |
| InChI | InChI=1S/C9H9F3N3/c1-6-3-4-7-13-14-8(9(10,11)12)15(7,2)5-6/h3-5H,1-2H3/q+1 |
| InChIKey | UIZMMFIAABPGFJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|