C27H46O5Si3 — CID 123549424
3-[di(cyclohexa-2,4-dien-1-yl)-[3-(2-trimethylsilyloxyethoxy)propyl]silyl]oxysilylpropyl 2-methylprop-2-enoate (PubChem CID 123549424) has the molecular formula C27H46O5Si3 and a molecular weight of 534.92 g/mol. Its IUPAC name is 3-[di(cyclohexa-2,4-dien-1-yl)-[3-(2-trimethylsilyloxyethoxy)propyl]silyl]oxysilylpropyl 2-methylprop-2-enoate.
| Compound Name | 3-[di(cyclohexa-2,4-dien-1-yl)-[3-(2-trimethylsilyloxyethoxy)propyl]silyl]oxysilylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123549424 |
| Molecular Formula | C27H46O5Si3 |
| Molecular Weight | 534.92 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | 3-[di(cyclohexa-2,4-dien-1-yl)-[3-(2-trimethylsilyloxyethoxy)propyl]silyl]oxysilylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[SiH2]O[Si](CCCOCCO[Si](C)(C)C)(C1C=CC=CC1)C1C=CC=CC1 |
| InChI | InChI=1S/C27H46O5Si3/c1-24(2)27(28)30-19-12-22-33-32-35(25-14-8-6-9-15-25,26-16-10-7-11-17-26)23-13-18-29-20-21-31-34(3,4)5/h6-11,14,16,25-26H,1,12-13,15,17-23,33H2,2-5H3 |
| InChIKey | ZJFIBNLORAORBW-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.92 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|