C23H29N3 — CID 123550414
6-cyclohexa-2,4-dien-1-yl-8-[(4-methylphenyl)methyl]-2-propyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine (PubChem CID 123550414) has the molecular formula C23H29N3 and a molecular weight of 347.51 g/mol. Its IUPAC name is 6-cyclohexa-2,4-dien-1-yl-8-[(4-methylphenyl)methyl]-2-propyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine.
| Compound Name | 6-cyclohexa-2,4-dien-1-yl-8-[(4-methylphenyl)methyl]-2-propyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 123550414 |
| Molecular Formula | C23H29N3 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | 6-cyclohexa-2,4-dien-1-yl-8-[(4-methylphenyl)methyl]-2-propyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine |
| SMILES | CCCc1cn2c(n1)C(Cc1ccc(C)cc1)NC(C1C=CC=CC1)C2 |
| InChI | InChI=1S/C23H29N3/c1-3-7-20-15-26-16-22(19-8-5-4-6-9-19)25-21(23(26)24-20)14-18-12-10-17(2)11-13-18/h4-6,8,10-13,15,19,21-22,25H,3,7,9,14,16H2,1-2H3 |
| InChIKey | IVXIFZLLXZDSRD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |