C25H34F2N6O — CID 123550656
5-[5-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-6-bicyclo[3.1.0]hexanyl]-1-propan-2-ylpyrazol-3-yl]-3-(difluoromethoxy)pyridin-2-amine (PubChem CID 123550656) has the molecular formula C25H34F2N6O and a molecular weight of 472.58 g/mol. Its IUPAC name is 5-[5-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-6-bicyclo[3.1.0]hexanyl]-1-propan-2-ylpyrazol-3-yl]-3-(difluoromethoxy)pyridin-2-amine.
| Compound Name | 5-[5-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-6-bicyclo[3.1.0]hexanyl]-1-propan-2-ylpyrazol-3-yl]-3-(difluoromethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 123550656 |
| Molecular Formula | C25H34F2N6O |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 5-[5-[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-6-bicyclo[3.1.0]hexanyl]-1-propan-2-ylpyrazol-3-yl]-3-(difluoromethoxy)pyridin-2-amine |
| SMILES | CC(C)n1nc(-c2cnc(N)c(OC(F)F)c2)cc1C1C2CC(N3CCN4CCCC4C3)CC21 |
| InChI | InChI=1S/C25H34F2N6O/c1-14(2)33-21(11-20(30-33)15-8-22(34-25(26)27)24(28)29-12-15)23-18-9-17(10-19(18)23)32-7-6-31-5-3-4-16(31)13-32/h8,11-12,14,16-19,23,25H,3-7,9-10,13H2,1-2H3,(H2,28,29) |
| InChIKey | CWBNERNUZZDDNN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |