C17H22N4O3S — CID 123550847
2-[(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)-propylamino]ethyl methanesulfonate (PubChem CID 123550847) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is 2-[(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)-propylamino]ethyl methanesulfonate.
| Compound Name | 2-[(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)-propylamino]ethyl methanesulfonate |
|---|---|
| PubChem CID | 123550847 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-[(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)-propylamino]ethyl methanesulfonate |
| SMILES | CCCN(CCOS(C)(=O)=O)c1ccc2c3cnccc3n(C)c2n1 |
| InChI | InChI=1S/C17H22N4O3S/c1-4-9-21(10-11-24-25(3,22)23)16-6-5-13-14-12-18-8-7-15(14)20(2)17(13)19-16/h5-8,12H,4,9-11H2,1-3H3 |
| InChIKey | JUKGKUCTXLJOTA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|