C20H31F2N5O2 — CID 123551060
2-amino-3-[amino-[3-(2-hydroxyethoxy)cyclopentyl]amino]-N'-[2-(3,4-difluorophenyl)cyclopropyl]butanimidamide (PubChem CID 123551060) has the molecular formula C20H31F2N5O2 and a molecular weight of 411.50 g/mol. Its IUPAC name is 2-amino-3-[amino-[3-(2-hydroxyethoxy)cyclopentyl]amino]-N'-[2-(3,4-difluorophenyl)cyclopropyl]butanimidamide.
| Compound Name | 2-amino-3-[amino-[3-(2-hydroxyethoxy)cyclopentyl]amino]-N'-[2-(3,4-difluorophenyl)cyclopropyl]butanimidamide |
|---|---|
| PubChem CID | 123551060 |
| Molecular Formula | C20H31F2N5O2 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 2-amino-3-[amino-[3-(2-hydroxyethoxy)cyclopentyl]amino]-N'-[2-(3,4-difluorophenyl)cyclopropyl]butanimidamide |
| SMILES | CC(C(N)/C(N)=N/C1CC1c1ccc(F)c(F)c1)N(N)C1CCC(OCCO)C1 |
| InChI | InChI=1S/C20H31F2N5O2/c1-11(27(25)13-3-4-14(9-13)29-7-6-28)19(23)20(24)26-18-10-15(18)12-2-5-16(21)17(22)8-12/h2,5,8,11,13-15,18-19,28H,3-4,6-7,9-10,23,25H2,1H3,(H2,24,26) |
| InChIKey | OFGJMKPUXOEUSP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 123.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|