C25H30FN3O — CID 123551125
N-butyl-6-(4-fluorocyclohexa-2,4-dien-1-yl)-8-methoxy-2-(2,3,4,5-tetrahydropyridin-3-yl)quinolin-4-amine (PubChem CID 123551125) has the molecular formula C25H30FN3O and a molecular weight of 407.53 g/mol. Its IUPAC name is N-butyl-6-(4-fluorocyclohexa-2,4-dien-1-yl)-8-methoxy-2-(2,3,4,5-tetrahydropyridin-3-yl)quinolin-4-amine.
| Compound Name | N-butyl-6-(4-fluorocyclohexa-2,4-dien-1-yl)-8-methoxy-2-(2,3,4,5-tetrahydropyridin-3-yl)quinolin-4-amine |
|---|---|
| PubChem CID | 123551125 |
| Molecular Formula | C25H30FN3O |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | N-butyl-6-(4-fluorocyclohexa-2,4-dien-1-yl)-8-methoxy-2-(2,3,4,5-tetrahydropyridin-3-yl)quinolin-4-amine |
| SMILES | CCCCNc1cc(C2CCC=NC2)nc2c(OC)cc(C3C=CC(F)=CC3)cc12 |
| InChI | InChI=1S/C25H30FN3O/c1-3-4-12-28-23-15-22(18-6-5-11-27-16-18)29-25-21(23)13-19(14-24(25)30-2)17-7-9-20(26)10-8-17/h7,9-11,13-15,17-18H,3-6,8,12,16H2,1-2H3,(H,28,29) |
| InChIKey | HVIFHGATELFVRW-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|