C22H30O4S — CID 123551938
3-[[4-(2,5-dimethylheptan-3-yl)phenoxy]methyl]benzenesulfonic acid (PubChem CID 123551938) has the molecular formula C22H30O4S and a molecular weight of 390.55 g/mol. Its IUPAC name is 3-[[4-(2,5-dimethylheptan-3-yl)phenoxy]methyl]benzenesulfonic acid.
| Compound Name | 3-[[4-(2,5-dimethylheptan-3-yl)phenoxy]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 123551938 |
| Molecular Formula | C22H30O4S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 3-[[4-(2,5-dimethylheptan-3-yl)phenoxy]methyl]benzenesulfonic acid |
| SMILES | CCC(C)CC(c1ccc(OCc2cccc(S(=O)(=O)O)c2)cc1)C(C)C |
| InChI | InChI=1S/C22H30O4S/c1-5-17(4)13-22(16(2)3)19-9-11-20(12-10-19)26-15-18-7-6-8-21(14-18)27(23,24)25/h6-12,14,16-17,22H,5,13,15H2,1-4H3,(H,23,24,25) |
| InChIKey | NDUKYLZYMDMPKL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|