C20H21F3N9O2+ — CID 123552298
9-methyl-6-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]-N-(2,2,2-trifluoroethyl)-7H-purin-9-ium-8-carboxamide (PubChem CID 123552298) has the molecular formula C20H21F3N9O2+ and a molecular weight of 476.44 g/mol. Its IUPAC name is 9-methyl-6-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]-N-(2,2,2-trifluoroethyl)-7H-purin-9-ium-8-carboxamide.
| Compound Name | 9-methyl-6-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]-N-(2,2,2-trifluoroethyl)-7H-purin-9-ium-8-carboxamide |
|---|---|
| PubChem CID | 123552298 |
| Molecular Formula | C20H21F3N9O2+ |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 9-methyl-6-[4-(2-oxo-3H-imidazo[4,5-b]pyridin-1-yl)piperidin-1-yl]-N-(2,2,2-trifluoroethyl)-7H-purin-9-ium-8-carboxamide |
| SMILES | C[n+]1c(C(=O)NCC(F)(F)F)[nH]c2c(N3CCC(n4c(=O)[nH]c5ncccc54)CC3)ncnc21 |
| InChI | InChI=1S/C20H20F3N9O2/c1-30-15-13(28-17(30)18(33)25-9-20(21,22)23)16(27-10-26-15)31-7-4-11(5-8-31)32-12-3-2-6-24-14(12)29-19(32)34/h2-3,6,10-11H,4-5,7-9H2,1H3,(H2,24,25,29,33,34)/p+1 |
| InChIKey | QGTVMSLLJRXLRO-UHFFFAOYSA-O |
| XLogP | 0.95 |
| TPSA | 128.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|