C19H33NO3 — CID 123552470
N,N-diethylethanamine;ethyl 4-methylbenzoate;prop-2-en-1-ol (PubChem CID 123552470) has the molecular formula C19H33NO3 and a molecular weight of 323.48 g/mol. Its IUPAC name is N,N-diethylethanamine;ethyl 4-methylbenzoate;prop-2-en-1-ol.
| Compound Name | N,N-diethylethanamine;ethyl 4-methylbenzoate;prop-2-en-1-ol |
|---|---|
| PubChem CID | 123552470 |
| Molecular Formula | C19H33NO3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.25 |
| IUPAC Name | N,N-diethylethanamine;ethyl 4-methylbenzoate;prop-2-en-1-ol |
| SMILES | C=CCO.CCN(CC)CC.CCOC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C10H12O2.C6H15N.C3H6O/c1-3-12-10(11)9-6-4-8(2)5-7-9;1-4-7(5-2)6-3;1-2-3-4/h4-7H,3H2,1-2H3;4-6H2,1-3H3;2,4H,1,3H2 |
| InChIKey | ASZYVORLPHEHDZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|