C16H21BN4O2 — CID 123553291
2-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyrimidin-4-amine (PubChem CID 123553291) has the molecular formula C16H21BN4O2 and a molecular weight of 312.18 g/mol. Its IUPAC name is 2-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyrimidin-4-amine.
| Compound Name | 2-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 123553291 |
| Molecular Formula | C16H21BN4O2 |
| Molecular Weight | 312.18 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 2-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyrimidin-4-amine |
| SMILES | Cc1nccc(Nc2cc(B3OC(C)(C)C(C)(C)O3)ccn2)n1 |
| InChI | InChI=1S/C16H21BN4O2/c1-11-18-9-7-13(20-11)21-14-10-12(6-8-19-14)17-22-15(2,3)16(4,5)23-17/h6-10H,1-5H3,(H,18,19,20,21) |
| InChIKey | JXHJEVZUXZHQEQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.18 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|