C8H14N2 — CID 123553502
2-N-methyl-1-N-propylbut-3-ene-1,2-diimine (PubChem CID 123553502) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 2-N-methyl-1-N-propylbut-3-ene-1,2-diimine.
| Compound Name | 2-N-methyl-1-N-propylbut-3-ene-1,2-diimine |
|---|---|
| PubChem CID | 123553502 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 2-N-methyl-1-N-propylbut-3-ene-1,2-diimine |
| SMILES | C=CC(/C=N/CCC)=N\C |
| InChI | InChI=1S/C8H14N2/c1-4-6-10-7-8(5-2)9-3/h5,7H,2,4,6H2,1,3H3/b9-8+,10-7+ |
| InChIKey | OLZFWZJLGIIESS-DGLUDJRXSA-N |
| XLogP | 1.72 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|