C13H18N2O2 — CID 123553507
1-(4,7-dimethylcyclohepta-1,3-dien-1-yl)piperazine-2,5-dione (PubChem CID 123553507) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-(4,7-dimethylcyclohepta-1,3-dien-1-yl)piperazine-2,5-dione.
| Compound Name | 1-(4,7-dimethylcyclohepta-1,3-dien-1-yl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 123553507 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-(4,7-dimethylcyclohepta-1,3-dien-1-yl)piperazine-2,5-dione |
| SMILES | CC1=CC=C(N2CC(=O)NCC2=O)C(C)CC1 |
| InChI | InChI=1S/C13H18N2O2/c1-9-3-5-10(2)11(6-4-9)15-8-12(16)14-7-13(15)17/h4,6,10H,3,5,7-8H2,1-2H3,(H,14,16) |
| InChIKey | XAOCBDOFXJKGQI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |