About 3-chloro-4-methyl-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide
3-chloro-4-methyl-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide (PubChem CID 123553811) has the molecular formula C10H11ClF3NO2S
and a molecular weight of 301.72 g/mol. Its IUPAC name is 3-chloro-4-methyl-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-chloro-4-methyl-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide |
| PubChem CID | 123553811 |
| Molecular Formula | C10H11ClF3NO2S |
| Molecular Weight | 301.72 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 3-chloro-4-methyl-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H11ClF3NO2S/c1-6-3-4-8(5-9(6)11)18(16,17)15-7(2)10(12,13)14/h3-5,7,15H,1-2H3 |
| InChIKey | RPZXGGJJQVQLPG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.72 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-4-methyl-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-methyl-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide?
The IUPAC name of 3-chloro-4-methyl-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide (CID 123553811) is 3-chloro-4-methyl-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide.
What is the SMILES notation for 3-chloro-4-methyl-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide?
The canonical SMILES for 3-chloro-4-methyl-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide is Cc1ccc(S(=O)(=O)NC(C)C(F)(F)F)cc1Cl.
What is the InChIKey of 3-chloro-4-methyl-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide?
The InChIKey is RPZXGGJJQVQLPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClF3NO2S/c1-6-3-4-8(5-9(6)11)18(16,17)15-7(2)10(12,13)14/h3-5,7,15H,1-2H3.
What are the key properties of 3-chloro-4-methyl-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide?
3-chloro-4-methyl-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide has a molecular weight of 301.72 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-methyl-N-(1,1,1-trifluoropropan-2-yl)benzenesulfonamide is sourced from PubChem (CID 123553811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).