C16H23N — CID 123554059
N-cyclohexa-1,5-dien-1-yl-7,7-dimethylocta-1,4-dien-3-imine (PubChem CID 123554059) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-7,7-dimethylocta-1,4-dien-3-imine.
| Compound Name | N-cyclohexa-1,5-dien-1-yl-7,7-dimethylocta-1,4-dien-3-imine |
|---|---|
| PubChem CID | 123554059 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-7,7-dimethylocta-1,4-dien-3-imine |
| SMILES | C=C/C(C=CCC(C)(C)C)=N\C1=CCCC=C1 |
| InChI | InChI=1S/C16H23N/c1-5-14(12-9-13-16(2,3)4)17-15-10-7-6-8-11-15/h5,7,9-12H,1,6,8,13H2,2-4H3/b12-9?,17-14+ |
| InChIKey | FXXLQHWWYYKHCU-UQGMWKSPSA-N |
| XLogP | 4.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|