About 4,5-dimethyltricyclo[4.4.0.03,8]dec-4-ene
4,5-dimethyltricyclo[4.4.0.03,8]dec-4-ene (PubChem CID 123554248) has the molecular formula C12H18
and a molecular weight of 162.28 g/mol. Its IUPAC name is 4,5-dimethyltricyclo[4.4.0.03,8]dec-4-ene.
Molecular Properties
| Compound Name | 4,5-dimethyltricyclo[4.4.0.03,8]dec-4-ene |
| PubChem CID | 123554248 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 4,5-dimethyltricyclo[4.4.0.03,8]dec-4-ene |
| SMILES | CC1=C(C)C2CC3CCC2CC13 |
| InChI | InChI=1S/C12H18/c1-7-8(2)12-6-9-3-4-10(12)5-11(7)9/h9-12H,3-6H2,1-2H3 |
| InChIKey | UOCZBLRLYFTVEF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyltricyclo[4.4.0.03,8]dec-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyltricyclo[4.4.0.03,8]dec-4-ene?
The IUPAC name of 4,5-dimethyltricyclo[4.4.0.03,8]dec-4-ene (CID 123554248) is 4,5-dimethyltricyclo[4.4.0.03,8]dec-4-ene.
What is the SMILES notation for 4,5-dimethyltricyclo[4.4.0.03,8]dec-4-ene?
The canonical SMILES for 4,5-dimethyltricyclo[4.4.0.03,8]dec-4-ene is CC1=C(C)C2CC3CCC2CC13.
What is the InChIKey of 4,5-dimethyltricyclo[4.4.0.03,8]dec-4-ene?
The InChIKey is UOCZBLRLYFTVEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18/c1-7-8(2)12-6-9-3-4-10(12)5-11(7)9/h9-12H,3-6H2,1-2H3.
What are the key properties of 4,5-dimethyltricyclo[4.4.0.03,8]dec-4-ene?
4,5-dimethyltricyclo[4.4.0.03,8]dec-4-ene has a molecular weight of 162.28 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyltricyclo[4.4.0.03,8]dec-4-ene is sourced from PubChem (CID 123554248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).