C25H36FN5O2 — CID 123554357
1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl-[3-[1-[2-[(4-fluoropiperidin-1-yl)methyl]phenyl]ethyl]imidazol-4-yl]methanol (PubChem CID 123554357) has the molecular formula C25H36FN5O2 and a molecular weight of 457.59 g/mol. Its IUPAC name is 1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl-[3-[1-[2-[(4-fluoropiperidin-1-yl)methyl]phenyl]ethyl]imidazol-4-yl]methanol.
| Compound Name | 1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl-[3-[1-[2-[(4-fluoropiperidin-1-yl)methyl]phenyl]ethyl]imidazol-4-yl]methanol |
|---|---|
| PubChem CID | 123554357 |
| Molecular Formula | C25H36FN5O2 |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | 1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl-[3-[1-[2-[(4-fluoropiperidin-1-yl)methyl]phenyl]ethyl]imidazol-4-yl]methanol |
| SMILES | CC(c1ccccc1CN1CCC(F)CC1)n1cncc1C(O)N1CCC2NCCOC2C1 |
| InChI | InChI=1S/C25H36FN5O2/c1-18(21-5-3-2-4-19(21)15-29-10-6-20(26)7-11-29)31-17-27-14-23(31)25(32)30-12-8-22-24(16-30)33-13-9-28-22/h2-5,14,17-18,20,22,24-25,28,32H,6-13,15-16H2,1H3 |
| InChIKey | XGXQMCRMOIRBBR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |