About propan-2-yl N-[4-[methyl(methylidene)-λ4-sulfanyl]butyl]carbamate
propan-2-yl N-[4-[methyl(methylidene)-λ4-sulfanyl]butyl]carbamate (PubChem CID 123554481) has the molecular formula C10H21NO2S
and a molecular weight of 219.35 g/mol. Its IUPAC name is propan-2-yl N-[4-[methyl(methylidene)-λ4-sulfanyl]butyl]carbamate.
Molecular Properties
| Compound Name | propan-2-yl N-[4-[methyl(methylidene)-λ4-sulfanyl]butyl]carbamate |
| PubChem CID | 123554481 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | propan-2-yl N-[4-[methyl(methylidene)-λ4-sulfanyl]butyl]carbamate |
| SMILES | C=S(C)CCCCNC(=O)OC(C)C |
| InChI | InChI=1S/C10H21NO2S/c1-9(2)13-10(12)11-7-5-6-8-14(3)4/h9H,3,5-8H2,1-2,4H3,(H,11,12) |
| InChIKey | UYZWISVSLHTMIS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl N-[4-[methyl(methylidene)-λ4-sulfanyl]butyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-[4-[methyl(methylidene)-λ4-sulfanyl]butyl]carbamate?
The IUPAC name of propan-2-yl N-[4-[methyl(methylidene)-λ4-sulfanyl]butyl]carbamate (CID 123554481) is propan-2-yl N-[4-[methyl(methylidene)-λ4-sulfanyl]butyl]carbamate.
What is the SMILES notation for propan-2-yl N-[4-[methyl(methylidene)-λ4-sulfanyl]butyl]carbamate?
The canonical SMILES for propan-2-yl N-[4-[methyl(methylidene)-λ4-sulfanyl]butyl]carbamate is C=S(C)CCCCNC(=O)OC(C)C.
What is the InChIKey of propan-2-yl N-[4-[methyl(methylidene)-λ4-sulfanyl]butyl]carbamate?
The InChIKey is UYZWISVSLHTMIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2S/c1-9(2)13-10(12)11-7-5-6-8-14(3)4/h9H,3,5-8H2,1-2,4H3,(H,11,12).
What are the key properties of propan-2-yl N-[4-[methyl(methylidene)-λ4-sulfanyl]butyl]carbamate?
propan-2-yl N-[4-[methyl(methylidene)-λ4-sulfanyl]butyl]carbamate has a molecular weight of 219.35 g/mol, XLogP of 2.23, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-[4-[methyl(methylidene)-λ4-sulfanyl]butyl]carbamate is sourced from PubChem (CID 123554481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).