C11H18FN — CID 123554630
6-fluoro-2,2-dimethyl-3,4,4a,5,6,8a-hexahydro-1H-quinoline (PubChem CID 123554630) has the molecular formula C11H18FN and a molecular weight of 183.27 g/mol. Its IUPAC name is 6-fluoro-2,2-dimethyl-3,4,4a,5,6,8a-hexahydro-1H-quinoline.
| Compound Name | 6-fluoro-2,2-dimethyl-3,4,4a,5,6,8a-hexahydro-1H-quinoline |
|---|---|
| PubChem CID | 123554630 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 6-fluoro-2,2-dimethyl-3,4,4a,5,6,8a-hexahydro-1H-quinoline |
| SMILES | CC1(C)CCC2CC(F)C=CC2N1 |
| InChI | InChI=1S/C11H18FN/c1-11(2)6-5-8-7-9(12)3-4-10(8)13-11/h3-4,8-10,13H,5-7H2,1-2H3 |
| InChIKey | ZJNTWPSXKJTASC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|