C24H31N3O3 — CID 123555397
2'-amino-6-(3-methoxy-6,7-dimethylcyclohepta-2,4-dien-1-yl)-2,2,3'-trimethylspiro[3H-chromene-4,5'-imidazole]-4'-one (PubChem CID 123555397) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 2'-amino-6-(3-methoxy-6,7-dimethylcyclohepta-2,4-dien-1-yl)-2,2,3'-trimethylspiro[3H-chromene-4,5'-imidazole]-4'-one.
| Compound Name | 2'-amino-6-(3-methoxy-6,7-dimethylcyclohepta-2,4-dien-1-yl)-2,2,3'-trimethylspiro[3H-chromene-4,5'-imidazole]-4'-one |
|---|---|
| PubChem CID | 123555397 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 2'-amino-6-(3-methoxy-6,7-dimethylcyclohepta-2,4-dien-1-yl)-2,2,3'-trimethylspiro[3H-chromene-4,5'-imidazole]-4'-one |
| SMILES | COC1=CC(c2ccc3c(c2)C2(CC(C)(C)O3)N=C(N)N(C)C2=O)C(C)C(C)C=C1 |
| InChI | InChI=1S/C24H31N3O3/c1-14-7-9-17(29-6)12-18(15(14)2)16-8-10-20-19(11-16)24(13-23(3,4)30-20)21(28)27(5)22(25)26-24/h7-12,14-15,18H,13H2,1-6H3,(H2,25,26) |
| InChIKey | GKQRVFZNPVSONH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |