C25H41N — CID 123555712
2-ethyl-N-(5-ethyl-6-methyl-7-propan-2-yldodeca-2,7,10-trien-3-yl)penta-1,4-dien-1-imine (PubChem CID 123555712) has the molecular formula C25H41N and a molecular weight of 355.61 g/mol. Its IUPAC name is 2-ethyl-N-(5-ethyl-6-methyl-7-propan-2-yldodeca-2,7,10-trien-3-yl)penta-1,4-dien-1-imine.
| Compound Name | 2-ethyl-N-(5-ethyl-6-methyl-7-propan-2-yldodeca-2,7,10-trien-3-yl)penta-1,4-dien-1-imine |
|---|---|
| PubChem CID | 123555712 |
| Molecular Formula | C25H41N |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 355.32 |
| IUPAC Name | 2-ethyl-N-(5-ethyl-6-methyl-7-propan-2-yldodeca-2,7,10-trien-3-yl)penta-1,4-dien-1-imine |
| SMILES | C=CCC(=C=NC(=CC)CC(CC)C(C)C(=CCC=CC)C(C)C)CC |
| InChI | InChI=1S/C25H41N/c1-9-14-15-17-25(20(6)7)21(8)23(12-4)18-24(13-5)26-19-22(11-3)16-10-2/h9-10,13-14,17,20-21,23H,2,11-12,15-16,18H2,1,3-8H3 |
| InChIKey | FUDSFAIPNLWUKR-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|