C31H41N5O — CID 123556311
2-(11,12-diethyl-10-methyl-4-azabicyclo[5.5.0]dodeca-1,3,9,11-tetraen-3-yl)-7-(3,4-dimethylpiperazin-1-yl)-9-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 123556311) has the molecular formula C31H41N5O and a molecular weight of 499.70 g/mol. Its IUPAC name is 2-(11,12-diethyl-10-methyl-4-azabicyclo[5.5.0]dodeca-1,3,9,11-tetraen-3-yl)-7-(3,4-dimethylpiperazin-1-yl)-9-methylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(11,12-diethyl-10-methyl-4-azabicyclo[5.5.0]dodeca-1,3,9,11-tetraen-3-yl)-7-(3,4-dimethylpiperazin-1-yl)-9-methylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 123556311 |
| Molecular Formula | C31H41N5O |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.33 |
| IUPAC Name | 2-(11,12-diethyl-10-methyl-4-azabicyclo[5.5.0]dodeca-1,3,9,11-tetraen-3-yl)-7-(3,4-dimethylpiperazin-1-yl)-9-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCC1=C(CC)C2=CC(c3cc(=O)n4cc(N5CCN(C)C(C)C5)cc(C)c4n3)=NCCC2CC=C1C |
| InChI | InChI=1S/C31H41N5O/c1-7-25-20(3)9-10-23-11-12-32-28(16-27(23)26(25)8-2)29-17-30(37)36-19-24(15-21(4)31(36)33-29)35-14-13-34(6)22(5)18-35/h9,15-17,19,22-23H,7-8,10-14,18H2,1-6H3 |
| InChIKey | YOPPLTBJKKXVDL-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 53.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |