C10H8N4 — CID 123556355
3,6-diimino-4,5-dimethylcyclohexa-1,4-diene-1,2-dicarbonitrile (PubChem CID 123556355) has the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. Its IUPAC name is 3,6-diimino-4,5-dimethylcyclohexa-1,4-diene-1,2-dicarbonitrile.
| Compound Name | 3,6-diimino-4,5-dimethylcyclohexa-1,4-diene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 123556355 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 3,6-diimino-4,5-dimethylcyclohexa-1,4-diene-1,2-dicarbonitrile |
| SMILES | [H]/N=C1\C(C)=C(C)/C(=N\[H])C(C#N)=C1C#N |
| InChI | InChI=1S/C10H8N4/c1-5-6(2)10(14)8(4-12)7(3-11)9(5)13/h13-14H,1-2H3/b13-9+,14-10+ |
| InChIKey | FGPDCYZIDJDEBE-UTLPMFLDSA-N |
| XLogP | 1.72 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|