C58H46O8 — CID 123556870
2-methyl-4-[4-[1,2,2-tris[4-(4-carboxy-3-methylphenyl)phenyl]ethyl]phenyl]benzoic acid (PubChem CID 123556870) has the molecular formula C58H46O8 and a molecular weight of 871.00 g/mol. Its IUPAC name is 2-methyl-4-[4-[1,2,2-tris[4-(4-carboxy-3-methylphenyl)phenyl]ethyl]phenyl]benzoic acid.
| Compound Name | 2-methyl-4-[4-[1,2,2-tris[4-(4-carboxy-3-methylphenyl)phenyl]ethyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 123556870 |
| Molecular Formula | C58H46O8 |
| Molecular Weight | 871.00 g/mol |
| Exact Mass | 870.32 |
| IUPAC Name | 2-methyl-4-[4-[1,2,2-tris[4-(4-carboxy-3-methylphenyl)phenyl]ethyl]phenyl]benzoic acid |
| SMILES | Cc1cc(-c2ccc(C(c3ccc(-c4ccc(C(=O)O)c(C)c4)cc3)C(c3ccc(-c4ccc(C(=O)O)c(C)c4)cc3)c3ccc(-c4ccc(C(=O)O)c(C)c4)cc3)cc2)ccc1C(=O)O |
| InChI | InChI=1S/C58H46O8/c1-33-29-45(21-25-49(33)55(59)60)37-5-13-41(14-6-37)53(42-15-7-38(8-16-42)46-22-26-50(56(61)62)34(2)30-46)54(43-17-9-39(10-18-43)47-23-27-51(57(63)64)35(3)31-47)44-19-11-40(12-20-44)48-24-28-52(58(65)66)36(4)32-48/h5-32,53-54H,1-4H3,(H,59,60)(H,61,62)(H,63,64)(H,65,66) |
| InChIKey | JMPRFZGEGXIWII-UHFFFAOYSA-N |
| XLogP | 13.35 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.00 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |