About 2-[[(3,4-dihydroxyphenyl)methylamino]methyl]-1,1-dimethylguanidine
2-[[(3,4-dihydroxyphenyl)methylamino]methyl]-1,1-dimethylguanidine (PubChem CID 123556977) has the molecular formula C11H18N4O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-[[(3,4-dihydroxyphenyl)methylamino]methyl]-1,1-dimethylguanidine.
Molecular Properties
| Compound Name | 2-[[(3,4-dihydroxyphenyl)methylamino]methyl]-1,1-dimethylguanidine |
| PubChem CID | 123556977 |
| Molecular Formula | C11H18N4O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 2-[[(3,4-dihydroxyphenyl)methylamino]methyl]-1,1-dimethylguanidine |
| SMILES | CN(C)C(N)=NCNCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H18N4O2/c1-15(2)11(12)14-7-13-6-8-3-4-9(16)10(17)5-8/h3-5,13,16-17H,6-7H2,1-2H3,(H2,12,14) |
| InChIKey | PPGDEXJQTHWYIJ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(3,4-dihydroxyphenyl)methylamino]methyl]-1,1-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3,4-dihydroxyphenyl)methylamino]methyl]-1,1-dimethylguanidine?
The IUPAC name of 2-[[(3,4-dihydroxyphenyl)methylamino]methyl]-1,1-dimethylguanidine (CID 123556977) is 2-[[(3,4-dihydroxyphenyl)methylamino]methyl]-1,1-dimethylguanidine.
What is the SMILES notation for 2-[[(3,4-dihydroxyphenyl)methylamino]methyl]-1,1-dimethylguanidine?
The canonical SMILES for 2-[[(3,4-dihydroxyphenyl)methylamino]methyl]-1,1-dimethylguanidine is CN(C)C(N)=NCNCc1ccc(O)c(O)c1.
What is the InChIKey of 2-[[(3,4-dihydroxyphenyl)methylamino]methyl]-1,1-dimethylguanidine?
The InChIKey is PPGDEXJQTHWYIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O2/c1-15(2)11(12)14-7-13-6-8-3-4-9(16)10(17)5-8/h3-5,13,16-17H,6-7H2,1-2H3,(H2,12,14).
What are the key properties of 2-[[(3,4-dihydroxyphenyl)methylamino]methyl]-1,1-dimethylguanidine?
2-[[(3,4-dihydroxyphenyl)methylamino]methyl]-1,1-dimethylguanidine has a molecular weight of 238.29 g/mol, XLogP of 0.02, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3,4-dihydroxyphenyl)methylamino]methyl]-1,1-dimethylguanidine is sourced from PubChem (CID 123556977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).