C26H32OS — CID 123557022
1-(1,7,8,8a-tetrahydronaphthalen-2-ylsulfanyl)-4-cyclohexyloxy-1,2,7,8-tetrahydronaphthalene (PubChem CID 123557022) has the molecular formula C26H32OS and a molecular weight of 392.61 g/mol. Its IUPAC name is 1-(1,7,8,8a-tetrahydronaphthalen-2-ylsulfanyl)-4-cyclohexyloxy-1,2,7,8-tetrahydronaphthalene.
| Compound Name | 1-(1,7,8,8a-tetrahydronaphthalen-2-ylsulfanyl)-4-cyclohexyloxy-1,2,7,8-tetrahydronaphthalene |
|---|---|
| PubChem CID | 123557022 |
| Molecular Formula | C26H32OS |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 1-(1,7,8,8a-tetrahydronaphthalen-2-ylsulfanyl)-4-cyclohexyloxy-1,2,7,8-tetrahydronaphthalene |
| SMILES | C1=CC2=C(CC1)C(SC1=CC=C3C=CCCC3C1)CC=C2OC1CCCCC1 |
| InChI | InChI=1S/C26H32OS/c1-2-10-21(11-3-1)27-25-16-17-26(24-13-7-6-12-23(24)25)28-22-15-14-19-8-4-5-9-20(19)18-22/h4,6,8,12,14-16,20-21,26H,1-3,5,7,9-11,13,17-18H2 |
| InChIKey | RZJLSNMAZYKANH-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |