C33H30N2O4 — CID 123557471
3,8-bis(2-ethyl-6-methylphenyl)-1-prop-1-enyl-3,8-phenanthroline-2,4,7,9-tetrone (PubChem CID 123557471) has the molecular formula C33H30N2O4 and a molecular weight of 518.61 g/mol. Its IUPAC name is 3,8-bis(2-ethyl-6-methylphenyl)-1-prop-1-enyl-3,8-phenanthroline-2,4,7,9-tetrone.
| Compound Name | 3,8-bis(2-ethyl-6-methylphenyl)-1-prop-1-enyl-3,8-phenanthroline-2,4,7,9-tetrone |
|---|---|
| PubChem CID | 123557471 |
| Molecular Formula | C33H30N2O4 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 3,8-bis(2-ethyl-6-methylphenyl)-1-prop-1-enyl-3,8-phenanthroline-2,4,7,9-tetrone |
| SMILES | CC=CC1=c2c(ccc3c2=CC(=O)N(c2c(C)cccc2CC)C3=O)C(=O)N(c2c(C)cccc2CC)C1=O |
| InChI | InChI=1S/C33H30N2O4/c1-6-11-24-28-25(33(39)35(32(24)38)30-20(5)13-10-15-22(30)8-3)17-16-23-26(28)18-27(36)34(31(23)37)29-19(4)12-9-14-21(29)7-2/h6,9-18H,7-8H2,1-5H3 |
| InChIKey | NUAMOAYQPUGGNF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|