C30H38ClN5O4 — CID 123557850
N-(6-chloro-3-methylocta-3,5,7-trienyl)-1-[2-(3,3-dimethylazetidin-1-yl)-2-oxoethyl]-5-[(3-hydroxypyrrolidin-1-yl)methyl]-2-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 123557850) has the molecular formula C30H38ClN5O4 and a molecular weight of 568.12 g/mol. Its IUPAC name is N-(6-chloro-3-methylocta-3,5,7-trienyl)-1-[2-(3,3-dimethylazetidin-1-yl)-2-oxoethyl]-5-[(3-hydroxypyrrolidin-1-yl)methyl]-2-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-(6-chloro-3-methylocta-3,5,7-trienyl)-1-[2-(3,3-dimethylazetidin-1-yl)-2-oxoethyl]-5-[(3-hydroxypyrrolidin-1-yl)methyl]-2-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 123557850 |
| Molecular Formula | C30H38ClN5O4 |
| Molecular Weight | 568.12 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | N-(6-chloro-3-methylocta-3,5,7-trienyl)-1-[2-(3,3-dimethylazetidin-1-yl)-2-oxoethyl]-5-[(3-hydroxypyrrolidin-1-yl)methyl]-2-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | C=CC(Cl)=CC=C(C)CCNC(=O)c1cc2c(CN3CCC(O)C3)ccnc2n(CC(=O)N2CC(C)(C)C2)c1=O |
| InChI | InChI=1S/C30H38ClN5O4/c1-5-22(31)7-6-20(2)8-11-33-28(39)25-14-24-21(15-34-13-10-23(37)16-34)9-12-32-27(24)36(29(25)40)17-26(38)35-18-30(3,4)19-35/h5-7,9,12,14,23,37H,1,8,10-11,13,15-19H2,2-4H3,(H,33,39) |
| InChIKey | LLDAZOOXOZBMGK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.12 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|