C29H29F3N2O2 — CID 123558071
1-[1-[[4-[(Z)-C-methyl-N-[[4-phenyl-3-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]methyl]pyrrolidin-3-yl]ethenol (PubChem CID 123558071) has the molecular formula C29H29F3N2O2 and a molecular weight of 494.56 g/mol. Its IUPAC name is 1-[1-[[4-[(Z)-C-methyl-N-[[4-phenyl-3-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]methyl]pyrrolidin-3-yl]ethenol.
| Compound Name | 1-[1-[[4-[(Z)-C-methyl-N-[[4-phenyl-3-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]methyl]pyrrolidin-3-yl]ethenol |
|---|---|
| PubChem CID | 123558071 |
| Molecular Formula | C29H29F3N2O2 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 1-[1-[[4-[(Z)-C-methyl-N-[[4-phenyl-3-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]methyl]pyrrolidin-3-yl]ethenol |
| SMILES | C=C(O)C1CCN(Cc2ccc(/C(C)=N\OCc3ccc(-c4ccccc4)c(C(F)(F)F)c3)cc2)C1 |
| InChI | InChI=1S/C29H29F3N2O2/c1-20(24-11-8-22(9-12-24)17-34-15-14-26(18-34)21(2)35)33-36-19-23-10-13-27(25-6-4-3-5-7-25)28(16-23)29(30,31)32/h3-13,16,26,35H,2,14-15,17-19H2,1H3/b33-20- |
| InChIKey | ADSWWUKOAOAVGG-UCMJSZAQSA-N |
| XLogP | 7.21 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|