C36H51N3O6Si3 — CID 123558463
1,3,5-tris(3-methoxysilyl-4-phenylbutyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 123558463) has the molecular formula C36H51N3O6Si3 and a molecular weight of 706.08 g/mol. Its IUPAC name is 1,3,5-tris(3-methoxysilyl-4-phenylbutyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris(3-methoxysilyl-4-phenylbutyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 123558463 |
| Molecular Formula | C36H51N3O6Si3 |
| Molecular Weight | 706.08 g/mol |
| Exact Mass | 705.31 |
| IUPAC Name | 1,3,5-tris(3-methoxysilyl-4-phenylbutyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CO[SiH2]C(CCn1c(=O)n(CCC(Cc2ccccc2)[SiH2]OC)c(=O)n(CCC(Cc2ccccc2)[SiH2]OC)c1=O)Cc1ccccc1 |
| InChI | InChI=1S/C36H51N3O6Si3/c1-43-46-31(25-28-13-7-4-8-14-28)19-22-37-34(40)38(23-20-32(47-44-2)26-29-15-9-5-10-16-29)36(42)39(35(37)41)24-21-33(48-45-3)27-30-17-11-6-12-18-30/h4-18,31-33H,19-27,46-48H2,1-3H3 |
| InChIKey | NLGZVURQWNQJBT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 93.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.08 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|