About tert-butyl N-[(Z)-3,4,4-trimethylpent-1-enyl]propanimidothioate
tert-butyl N-[(Z)-3,4,4-trimethylpent-1-enyl]propanimidothioate (PubChem CID 123558721) has the molecular formula C15H29NS
and a molecular weight of 255.47 g/mol. Its IUPAC name is tert-butyl N-[(Z)-3,4,4-trimethylpent-1-enyl]propanimidothioate.
Molecular Properties
| Compound Name | tert-butyl N-[(Z)-3,4,4-trimethylpent-1-enyl]propanimidothioate |
| PubChem CID | 123558721 |
| Molecular Formula | C15H29NS |
| Molecular Weight | 255.47 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | tert-butyl N-[(Z)-3,4,4-trimethylpent-1-enyl]propanimidothioate |
| SMILES | CC/C(=N\C=C/C(C)C(C)(C)C)SC(C)(C)C |
| InChI | InChI=1S/C15H29NS/c1-9-13(17-15(6,7)8)16-11-10-12(2)14(3,4)5/h10-12H,9H2,1-8H3/b11-10-,16-13+ |
| InChIKey | JXAMULHUWYLONQ-RXJLENPMSA-N |
| XLogP | 5.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 255.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(Z)-3,4,4-trimethylpent-1-enyl]propanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(Z)-3,4,4-trimethylpent-1-enyl]propanimidothioate?
The IUPAC name of tert-butyl N-[(Z)-3,4,4-trimethylpent-1-enyl]propanimidothioate (CID 123558721) is tert-butyl N-[(Z)-3,4,4-trimethylpent-1-enyl]propanimidothioate.
What is the SMILES notation for tert-butyl N-[(Z)-3,4,4-trimethylpent-1-enyl]propanimidothioate?
The canonical SMILES for tert-butyl N-[(Z)-3,4,4-trimethylpent-1-enyl]propanimidothioate is CC/C(=N\C=C/C(C)C(C)(C)C)SC(C)(C)C.
What is the InChIKey of tert-butyl N-[(Z)-3,4,4-trimethylpent-1-enyl]propanimidothioate?
The InChIKey is JXAMULHUWYLONQ-RXJLENPMSA-N. The full InChI is InChI=1S/C15H29NS/c1-9-13(17-15(6,7)8)16-11-10-12(2)14(3,4)5/h10-12H,9H2,1-8H3/b11-10-,16-13+.
What are the key properties of tert-butyl N-[(Z)-3,4,4-trimethylpent-1-enyl]propanimidothioate?
tert-butyl N-[(Z)-3,4,4-trimethylpent-1-enyl]propanimidothioate has a molecular weight of 255.47 g/mol, XLogP of 5.52, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(Z)-3,4,4-trimethylpent-1-enyl]propanimidothioate is sourced from PubChem (CID 123558721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).