C15H21F3N2 — CID 123558880
(4E,6E)-8-N-butyl-7-(trifluoromethyl)deca-4,6,9-triene-2,8-diimine (PubChem CID 123558880) has the molecular formula C15H21F3N2 and a molecular weight of 286.34 g/mol. Its IUPAC name is (4E,6E)-8-N-butyl-7-(trifluoromethyl)deca-4,6,9-triene-2,8-diimine.
| Compound Name | (4E,6E)-8-N-butyl-7-(trifluoromethyl)deca-4,6,9-triene-2,8-diimine |
|---|---|
| PubChem CID | 123558880 |
| Molecular Formula | C15H21F3N2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (4E,6E)-8-N-butyl-7-(trifluoromethyl)deca-4,6,9-triene-2,8-diimine |
| SMILES | [H]/N=C(\C)C/C=C/C=C(C(\C=C)=N\CCCC)/C(F)(F)F |
| InChI | InChI=1S/C15H21F3N2/c1-4-6-11-20-14(5-2)13(15(16,17)18)10-8-7-9-12(3)19/h5,7-8,10,19H,2,4,6,9,11H2,1,3H3/b8-7+,13-10+,19-12+,20-14+ |
| InChIKey | GLTIJIJQIQJQED-RMAGPJCPSA-N |
| XLogP | 4.89 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|