C31H31N3O5 — CID 123559213
2-[(6-methyl-4-oxo-1,2,3-benzotriazin-3-yl)methyl]-5-[4-(3-phenylpropoxy)benzoyl]cyclopentane-1-carboxylic acid (PubChem CID 123559213) has the molecular formula C31H31N3O5 and a molecular weight of 525.61 g/mol. Its IUPAC name is 2-[(6-methyl-4-oxo-1,2,3-benzotriazin-3-yl)methyl]-5-[4-(3-phenylpropoxy)benzoyl]cyclopentane-1-carboxylic acid.
| Compound Name | 2-[(6-methyl-4-oxo-1,2,3-benzotriazin-3-yl)methyl]-5-[4-(3-phenylpropoxy)benzoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 123559213 |
| Molecular Formula | C31H31N3O5 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 2-[(6-methyl-4-oxo-1,2,3-benzotriazin-3-yl)methyl]-5-[4-(3-phenylpropoxy)benzoyl]cyclopentane-1-carboxylic acid |
| SMILES | Cc1ccc2nnn(CC3CCC(C(=O)c4ccc(OCCCc5ccccc5)cc4)C3C(=O)O)c(=O)c2c1 |
| InChI | InChI=1S/C31H31N3O5/c1-20-9-16-27-26(18-20)30(36)34(33-32-27)19-23-12-15-25(28(23)31(37)38)29(35)22-10-13-24(14-11-22)39-17-5-8-21-6-3-2-4-7-21/h2-4,6-7,9-11,13-14,16,18,23,25,28H,5,8,12,15,17,19H2,1H3,(H,37,38) |
| InChIKey | IYTGQFCZIVXHPR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|