About N-ethyl-2,3,4-trimethyloxan-3-amine
N-ethyl-2,3,4-trimethyloxan-3-amine (PubChem CID 123559408) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is N-ethyl-2,3,4-trimethyloxan-3-amine.
Molecular Properties
| Compound Name | N-ethyl-2,3,4-trimethyloxan-3-amine |
| PubChem CID | 123559408 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | N-ethyl-2,3,4-trimethyloxan-3-amine |
| SMILES | CCNC1(C)C(C)CCOC1C |
| InChI | InChI=1S/C10H21NO/c1-5-11-10(4)8(2)6-7-12-9(10)3/h8-9,11H,5-7H2,1-4H3 |
| InChIKey | WSJXQZMWYXCUDC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-2,3,4-trimethyloxan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,3,4-trimethyloxan-3-amine?
The IUPAC name of N-ethyl-2,3,4-trimethyloxan-3-amine (CID 123559408) is N-ethyl-2,3,4-trimethyloxan-3-amine.
What is the SMILES notation for N-ethyl-2,3,4-trimethyloxan-3-amine?
The canonical SMILES for N-ethyl-2,3,4-trimethyloxan-3-amine is CCNC1(C)C(C)CCOC1C.
What is the InChIKey of N-ethyl-2,3,4-trimethyloxan-3-amine?
The InChIKey is WSJXQZMWYXCUDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO/c1-5-11-10(4)8(2)6-7-12-9(10)3/h8-9,11H,5-7H2,1-4H3.
What are the key properties of N-ethyl-2,3,4-trimethyloxan-3-amine?
N-ethyl-2,3,4-trimethyloxan-3-amine has a molecular weight of 171.28 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,3,4-trimethyloxan-3-amine is sourced from PubChem (CID 123559408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).