C7H12BrNS — CID 123559515
3-bromo-4-methyl-6-methylsulfanyl-1,2,3,6-tetrahydropyridine (PubChem CID 123559515) has the molecular formula C7H12BrNS and a molecular weight of 222.15 g/mol. Its IUPAC name is 3-bromo-4-methyl-6-methylsulfanyl-1,2,3,6-tetrahydropyridine.
| Compound Name | 3-bromo-4-methyl-6-methylsulfanyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 123559515 |
| Molecular Formula | C7H12BrNS |
| Molecular Weight | 222.15 g/mol |
| Exact Mass | 220.99 |
| IUPAC Name | 3-bromo-4-methyl-6-methylsulfanyl-1,2,3,6-tetrahydropyridine |
| SMILES | CSC1C=C(C)C(Br)CN1 |
| InChI | InChI=1S/C7H12BrNS/c1-5-3-7(10-2)9-4-6(5)8/h3,6-7,9H,4H2,1-2H3 |
| InChIKey | XSRXZCIRCSGOAF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.15 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|