C34H54N2O12 — CID 123559985
[4-amino-2-[(2-ethyl-9-methoxy-1,5,9,11,13-pentamethyl-4,6,16-trioxo-12-prop-2-enoxyimino-3,15,17-trioxabicyclo[12.3.0]heptadecan-8-yl)oxy]-6-methyloxepan-3-yl] acetate (PubChem CID 123559985) has the molecular formula C34H54N2O12 and a molecular weight of 682.81 g/mol. Its IUPAC name is [4-amino-2-[(2-ethyl-9-methoxy-1,5,9,11,13-pentamethyl-4,6,16-trioxo-12-prop-2-enoxyimino-3,15,17-trioxabicyclo[12.3.0]heptadecan-8-yl)oxy]-6-methyloxepan-3-yl] acetate.
| Compound Name | [4-amino-2-[(2-ethyl-9-methoxy-1,5,9,11,13-pentamethyl-4,6,16-trioxo-12-prop-2-enoxyimino-3,15,17-trioxabicyclo[12.3.0]heptadecan-8-yl)oxy]-6-methyloxepan-3-yl] acetate |
|---|---|
| PubChem CID | 123559985 |
| Molecular Formula | C34H54N2O12 |
| Molecular Weight | 682.81 g/mol |
| Exact Mass | 682.37 |
| IUPAC Name | [4-amino-2-[(2-ethyl-9-methoxy-1,5,9,11,13-pentamethyl-4,6,16-trioxo-12-prop-2-enoxyimino-3,15,17-trioxabicyclo[12.3.0]heptadecan-8-yl)oxy]-6-methyloxepan-3-yl] acetate |
| SMILES | C=CCON=C1C(C)CC(C)(OC)C(OC2OCC(C)CC(N)C2OC(C)=O)CC(=O)C(C)C(=O)OC(CC)C2(C)OC(=O)OC2C1C |
| InChI | InChI=1S/C34H54N2O12/c1-11-13-43-36-27-19(4)16-33(8,41-10)26(46-31-28(44-22(7)37)23(35)14-18(3)17-42-31)15-24(38)20(5)30(39)45-25(12-2)34(9)29(21(27)6)47-32(40)48-34/h11,18-21,23,25-26,28-29,31H,1,12-17,35H2,2-10H3 |
| InChIKey | VQRACCXXPPYWCJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 180.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.81 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|