About N-but-2-en-2-yl-5-(2,2-difluoroethoxy)pyrazine-2-carboxamide
N-but-2-en-2-yl-5-(2,2-difluoroethoxy)pyrazine-2-carboxamide (PubChem CID 123560137) has the molecular formula C11H13F2N3O2
and a molecular weight of 257.24 g/mol. Its IUPAC name is N-but-2-en-2-yl-5-(2,2-difluoroethoxy)pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | N-but-2-en-2-yl-5-(2,2-difluoroethoxy)pyrazine-2-carboxamide |
| PubChem CID | 123560137 |
| Molecular Formula | C11H13F2N3O2 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-but-2-en-2-yl-5-(2,2-difluoroethoxy)pyrazine-2-carboxamide |
| SMILES | CC=C(C)NC(=O)c1cnc(OCC(F)F)cn1 |
| InChI | InChI=1S/C11H13F2N3O2/c1-3-7(2)16-11(17)8-4-15-10(5-14-8)18-6-9(12)13/h3-5,9H,6H2,1-2H3,(H,16,17) |
| InChIKey | RQGOGCPDUPPYBD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-but-2-en-2-yl-5-(2,2-difluoroethoxy)pyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-2-en-2-yl-5-(2,2-difluoroethoxy)pyrazine-2-carboxamide?
The IUPAC name of N-but-2-en-2-yl-5-(2,2-difluoroethoxy)pyrazine-2-carboxamide (CID 123560137) is N-but-2-en-2-yl-5-(2,2-difluoroethoxy)pyrazine-2-carboxamide.
What is the SMILES notation for N-but-2-en-2-yl-5-(2,2-difluoroethoxy)pyrazine-2-carboxamide?
The canonical SMILES for N-but-2-en-2-yl-5-(2,2-difluoroethoxy)pyrazine-2-carboxamide is CC=C(C)NC(=O)c1cnc(OCC(F)F)cn1.
What is the InChIKey of N-but-2-en-2-yl-5-(2,2-difluoroethoxy)pyrazine-2-carboxamide?
The InChIKey is RQGOGCPDUPPYBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2N3O2/c1-3-7(2)16-11(17)8-4-15-10(5-14-8)18-6-9(12)13/h3-5,9H,6H2,1-2H3,(H,16,17).
What are the key properties of N-but-2-en-2-yl-5-(2,2-difluoroethoxy)pyrazine-2-carboxamide?
N-but-2-en-2-yl-5-(2,2-difluoroethoxy)pyrazine-2-carboxamide has a molecular weight of 257.24 g/mol, XLogP of 1.77, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-2-en-2-yl-5-(2,2-difluoroethoxy)pyrazine-2-carboxamide is sourced from PubChem (CID 123560137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).