C8H12O3Si — CID 123560153
8-silyl-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one (PubChem CID 123560153) has the molecular formula C8H12O3Si and a molecular weight of 184.27 g/mol. Its IUPAC name is 8-silyl-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one.
| Compound Name | 8-silyl-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one |
|---|---|
| PubChem CID | 123560153 |
| Molecular Formula | C8H12O3Si |
| Molecular Weight | 184.27 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 8-silyl-4,10-dioxatricyclo[5.2.1.02,6]decan-3-one |
| SMILES | O=C1OCC2C3OC(CC3[SiH3])C12 |
| InChI | InChI=1S/C8H12O3Si/c9-8-6-3(2-10-8)7-5(12)1-4(6)11-7/h3-7H,1-2H2,12H3 |
| InChIKey | ROXHIWOCMIJRCW-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.27 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|